2-{2-[(3-methylphenyl)carbamamido]-1,3-thiazol-4-yl}-N-(2-methylpropyl)acetamide
Chemical Structure Depiction of
2-{2-[(3-methylphenyl)carbamamido]-1,3-thiazol-4-yl}-N-(2-methylpropyl)acetamide
2-{2-[(3-methylphenyl)carbamamido]-1,3-thiazol-4-yl}-N-(2-methylpropyl)acetamide
Compound characteristics
| Compound ID: | F042-0891 |
| Compound Name: | 2-{2-[(3-methylphenyl)carbamamido]-1,3-thiazol-4-yl}-N-(2-methylpropyl)acetamide |
| Molecular Weight: | 346.45 |
| Molecular Formula: | C17 H22 N4 O2 S |
| Smiles: | CC(C)CNC(Cc1csc(NC(Nc2cccc(C)c2)=O)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7398 |
| logD: | 3.7397 |
| logSw: | -3.8768 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 67.554 |
| InChI Key: | AFIWEXVLWULGSH-UHFFFAOYSA-N |