2-(3-methylpiperidin-1-yl)-2-oxo-N-[(4-oxo-3,4-dihydrophthalazin-1-yl)methyl]acetamide
Chemical Structure Depiction of
2-(3-methylpiperidin-1-yl)-2-oxo-N-[(4-oxo-3,4-dihydrophthalazin-1-yl)methyl]acetamide
2-(3-methylpiperidin-1-yl)-2-oxo-N-[(4-oxo-3,4-dihydrophthalazin-1-yl)methyl]acetamide
Compound characteristics
| Compound ID: | F044-0015 |
| Compound Name: | 2-(3-methylpiperidin-1-yl)-2-oxo-N-[(4-oxo-3,4-dihydrophthalazin-1-yl)methyl]acetamide |
| Molecular Weight: | 328.37 |
| Molecular Formula: | C17 H20 N4 O3 |
| Smiles: | CC1CCCN(C1)C(C(NCC1c2ccccc2C(NN=1)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.8675 |
| logD: | 0.6021 |
| logSw: | -2.2192 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.8 |
| InChI Key: | WIOMIZWMBKNBAH-NSHDSACASA-N |