5-{[6-oxo-3-(4-phenylpiperazin-1-yl)pyridazin-1(6H)-yl]methyl}-N-[4-(propan-2-yl)phenyl]furan-2-carboxamide
Chemical Structure Depiction of
5-{[6-oxo-3-(4-phenylpiperazin-1-yl)pyridazin-1(6H)-yl]methyl}-N-[4-(propan-2-yl)phenyl]furan-2-carboxamide
5-{[6-oxo-3-(4-phenylpiperazin-1-yl)pyridazin-1(6H)-yl]methyl}-N-[4-(propan-2-yl)phenyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | F045-0068 |
| Compound Name: | 5-{[6-oxo-3-(4-phenylpiperazin-1-yl)pyridazin-1(6H)-yl]methyl}-N-[4-(propan-2-yl)phenyl]furan-2-carboxamide |
| Molecular Weight: | 497.6 |
| Molecular Formula: | C29 H31 N5 O3 |
| Smiles: | CC(C)c1ccc(cc1)NC(c1ccc(CN2C(C=CC(=N2)N2CCN(CC2)c2ccccc2)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1192 |
| logD: | 5.119 |
| logSw: | -4.9291 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.317 |
| InChI Key: | AAMCPVXIKSWDRW-UHFFFAOYSA-N |