N-(2-fluorophenyl)-2-[6-oxo-3-(4-phenylpiperazin-1-yl)pyridazin-1(6H)-yl]acetamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-2-[6-oxo-3-(4-phenylpiperazin-1-yl)pyridazin-1(6H)-yl]acetamide
N-(2-fluorophenyl)-2-[6-oxo-3-(4-phenylpiperazin-1-yl)pyridazin-1(6H)-yl]acetamide
Compound characteristics
| Compound ID: | F046-0140 |
| Compound Name: | N-(2-fluorophenyl)-2-[6-oxo-3-(4-phenylpiperazin-1-yl)pyridazin-1(6H)-yl]acetamide |
| Molecular Weight: | 407.45 |
| Molecular Formula: | C22 H22 F N5 O2 |
| Smiles: | C1CN(CCN1C1C=CC(N(CC(Nc2ccccc2F)=O)N=1)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 2.5586 |
| logD: | 2.5585 |
| logSw: | -2.886 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.836 |
| InChI Key: | ZQJGDMKJYZGUJN-UHFFFAOYSA-N |