N-(5-benzyl-4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridin-2-yl)-3,4,5-triethoxybenzamide
Chemical Structure Depiction of
N-(5-benzyl-4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridin-2-yl)-3,4,5-triethoxybenzamide
N-(5-benzyl-4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridin-2-yl)-3,4,5-triethoxybenzamide
Compound characteristics
| Compound ID: | F048-0722 |
| Compound Name: | N-(5-benzyl-4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridin-2-yl)-3,4,5-triethoxybenzamide |
| Molecular Weight: | 481.61 |
| Molecular Formula: | C26 H31 N3 O4 S |
| Smiles: | CCOc1cc(cc(c1OCC)OCC)C(Nc1nc2CCN(Cc3ccccc3)Cc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.793 |
| logD: | 4.2345 |
| logSw: | -4.403 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.989 |
| InChI Key: | RALKYWQGHYUAHH-UHFFFAOYSA-N |