N-(4-chlorophenyl)-4-methyl-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
					Chemical Structure Depiction of
N-(4-chlorophenyl)-4-methyl-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
			N-(4-chlorophenyl)-4-methyl-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
Compound characteristics
| Compound ID: | F053-0032 | 
| Compound Name: | N-(4-chlorophenyl)-4-methyl-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide | 
| Molecular Weight: | 354.87 | 
| Molecular Formula: | C15 H15 Cl N2 O2 S2 | 
| Smiles: | CN1CCSc2ccc(cc12)S(Nc1ccc(cc1)[Cl])(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.7578 | 
| logD: | 3.0914 | 
| logSw: | -4.2181 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 43.438 | 
| InChI Key: | WFENHHRNBQQIGK-UHFFFAOYSA-N | 
 
				 
				