N-(2,3-dimethylphenyl)-1-methyl-1H-benzotriazole-5-carboxamide
Chemical Structure Depiction of
N-(2,3-dimethylphenyl)-1-methyl-1H-benzotriazole-5-carboxamide
N-(2,3-dimethylphenyl)-1-methyl-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | F058-0047 |
| Compound Name: | N-(2,3-dimethylphenyl)-1-methyl-1H-benzotriazole-5-carboxamide |
| Molecular Weight: | 280.33 |
| Molecular Formula: | C16 H16 N4 O |
| Smiles: | Cc1cccc(c1C)NC(c1ccc2c(c1)nnn2C)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8027 |
| logD: | 2.8026 |
| logSw: | -3.1809 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.615 |
| InChI Key: | OFRIHHJLQOYDGA-UHFFFAOYSA-N |