N-(3-chloro-2-methylphenyl)-1-cyclopentyl-1H-benzotriazole-5-carboxamide
Chemical Structure Depiction of
N-(3-chloro-2-methylphenyl)-1-cyclopentyl-1H-benzotriazole-5-carboxamide
N-(3-chloro-2-methylphenyl)-1-cyclopentyl-1H-benzotriazole-5-carboxamide
Compound characteristics
| Compound ID: | F058-1269 |
| Compound Name: | N-(3-chloro-2-methylphenyl)-1-cyclopentyl-1H-benzotriazole-5-carboxamide |
| Molecular Weight: | 354.84 |
| Molecular Formula: | C19 H19 Cl N4 O |
| Smiles: | Cc1c(cccc1[Cl])NC(c1ccc2c(c1)nnn2C1CCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4102 |
| logD: | 4.3997 |
| logSw: | -4.5129 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.393 |
| InChI Key: | FTWASSMDYWJNHN-UHFFFAOYSA-N |