1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-methylpiperidine-3-carboxamide
Chemical Structure Depiction of
1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-methylpiperidine-3-carboxamide
1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-methylpiperidine-3-carboxamide
Compound characteristics
| Compound ID: | F061-0918 |
| Compound Name: | 1-{5-[2-(2-fluorophenyl)ethenyl]-3-methyl-1,2-oxazole-4-sulfonyl}-N-methylpiperidine-3-carboxamide |
| Molecular Weight: | 407.46 |
| Molecular Formula: | C19 H22 F N3 O4 S |
| Smiles: | Cc1c(c(/C=C/c2ccccc2F)on1)S(N1CCCC(C1)C(NC)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7593 |
| logD: | 1.7593 |
| logSw: | -2.4994 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.234 |
| InChI Key: | UZJCHSVWLNCMRW-HNNXBMFYSA-N |