1-{3-methyl-5-[2-(2,4,6-trimethylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}-N-[(thiophen-2-yl)methyl]piperidine-3-carboxamide
Chemical Structure Depiction of
1-{3-methyl-5-[2-(2,4,6-trimethylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}-N-[(thiophen-2-yl)methyl]piperidine-3-carboxamide
1-{3-methyl-5-[2-(2,4,6-trimethylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}-N-[(thiophen-2-yl)methyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | F061-1859 |
| Compound Name: | 1-{3-methyl-5-[2-(2,4,6-trimethylphenyl)ethenyl]-1,2-oxazole-4-sulfonyl}-N-[(thiophen-2-yl)methyl]piperidine-3-carboxamide |
| Molecular Weight: | 513.68 |
| Molecular Formula: | C26 H31 N3 O4 S2 |
| Smiles: | Cc1cc(C)c(/C=C/c2c(c(C)no2)S(N2CCCC(C2)C(NCc2cccs2)=O)(=O)=O)c(C)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3666 |
| logD: | 4.3666 |
| logSw: | -4.2028 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.83 |
| InChI Key: | UDOQWZMGYBGNJS-NRFANRHFSA-N |