N-(4-chloro-2-methylphenyl)-N~2~-(4-methylphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide
Chemical Structure Depiction of
N-(4-chloro-2-methylphenyl)-N~2~-(4-methylphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide
N-(4-chloro-2-methylphenyl)-N~2~-(4-methylphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | F062-0036 |
| Compound Name: | N-(4-chloro-2-methylphenyl)-N~2~-(4-methylphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide |
| Molecular Weight: | 460.98 |
| Molecular Formula: | C22 H25 Cl N4 O3 S |
| Smiles: | Cc1ccc(cc1)N(CC(Nc1ccc(cc1C)[Cl])=O)S(c1c(C)nn(C)c1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5029 |
| logD: | 3.5027 |
| logSw: | -3.882 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.083 |
| InChI Key: | QJVXGPAREHXNNV-UHFFFAOYSA-N |