N-(2-fluorophenyl)-N~2~-(4-methylphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-N~2~-(4-methylphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide
N-(2-fluorophenyl)-N~2~-(4-methylphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | F062-0059 |
| Compound Name: | N-(2-fluorophenyl)-N~2~-(4-methylphenyl)-N~2~-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)glycinamide |
| Molecular Weight: | 430.5 |
| Molecular Formula: | C21 H23 F N4 O3 S |
| Smiles: | Cc1ccc(cc1)N(CC(Nc1ccccc1F)=O)S(c1c(C)nn(C)c1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4224 |
| logD: | 2.4222 |
| logSw: | -2.8873 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.083 |
| InChI Key: | FYSCFBJZPYSBBM-UHFFFAOYSA-N |