methyl 4-{2-[(3-chloro-4-methoxyphenyl)carbamoyl]pyrrolidine-1-sulfonyl}-1-methyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 4-{2-[(3-chloro-4-methoxyphenyl)carbamoyl]pyrrolidine-1-sulfonyl}-1-methyl-1H-pyrrole-2-carboxylate
methyl 4-{2-[(3-chloro-4-methoxyphenyl)carbamoyl]pyrrolidine-1-sulfonyl}-1-methyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | F065-0161 |
| Compound Name: | methyl 4-{2-[(3-chloro-4-methoxyphenyl)carbamoyl]pyrrolidine-1-sulfonyl}-1-methyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 455.92 |
| Molecular Formula: | C19 H22 Cl N3 O6 S |
| Smiles: | Cn1cc(cc1C(=O)OC)S(N1CCCC1C(Nc1ccc(c(c1)[Cl])OC)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.744 |
| logD: | 1.7367 |
| logSw: | -2.958 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 86.992 |
| InChI Key: | IETSXGGGSJDXGW-HNNXBMFYSA-N |