ethyl 4-{2-[(4-acetylphenyl)carbamoyl]pyrrolidine-1-sulfonyl}-1-methyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 4-{2-[(4-acetylphenyl)carbamoyl]pyrrolidine-1-sulfonyl}-1-methyl-1H-pyrrole-2-carboxylate
ethyl 4-{2-[(4-acetylphenyl)carbamoyl]pyrrolidine-1-sulfonyl}-1-methyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | F065-0398 |
| Compound Name: | ethyl 4-{2-[(4-acetylphenyl)carbamoyl]pyrrolidine-1-sulfonyl}-1-methyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 447.51 |
| Molecular Formula: | C21 H25 N3 O6 S |
| Smiles: | CCOC(c1cc(cn1C)S(N1CCCC1C(Nc1ccc(cc1)C(C)=O)=O)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.2304 |
| logD: | 1.2248 |
| logSw: | -2.4489 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 92.768 |
| InChI Key: | URTDOKADYWBTNY-SFHVURJKSA-N |