methyl 4-[(2-{[(2-methoxyphenyl)methyl]amino}-2-oxoethyl)(methyl)sulfamoyl]-1-methyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 4-[(2-{[(2-methoxyphenyl)methyl]amino}-2-oxoethyl)(methyl)sulfamoyl]-1-methyl-1H-pyrrole-2-carboxylate
methyl 4-[(2-{[(2-methoxyphenyl)methyl]amino}-2-oxoethyl)(methyl)sulfamoyl]-1-methyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | F065-3632 |
| Compound Name: | methyl 4-[(2-{[(2-methoxyphenyl)methyl]amino}-2-oxoethyl)(methyl)sulfamoyl]-1-methyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 409.46 |
| Molecular Formula: | C18 H23 N3 O6 S |
| Smiles: | CN(CC(NCc1ccccc1OC)=O)S(c1cc(C(=O)OC)n(C)c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.0701 |
| logD: | 1.0701 |
| logSw: | -2.52 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 88.388 |
| InChI Key: | NDMLSVRKEHSZFW-UHFFFAOYSA-N |