ethyl 4-[(2-{[(4-chlorophenyl)methyl]amino}-2-oxoethyl)sulfamoyl]-1-methyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 4-[(2-{[(4-chlorophenyl)methyl]amino}-2-oxoethyl)sulfamoyl]-1-methyl-1H-pyrrole-2-carboxylate
ethyl 4-[(2-{[(4-chlorophenyl)methyl]amino}-2-oxoethyl)sulfamoyl]-1-methyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | F065-3923 |
| Compound Name: | ethyl 4-[(2-{[(4-chlorophenyl)methyl]amino}-2-oxoethyl)sulfamoyl]-1-methyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 413.88 |
| Molecular Formula: | C17 H20 Cl N3 O5 S |
| Smiles: | CCOC(c1cc(cn1C)S(NCC(NCc1ccc(cc1)[Cl])=O)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8806 |
| logD: | 1.8798 |
| logSw: | -3.0217 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 89.532 |
| InChI Key: | HXAABDLJJAWBAK-UHFFFAOYSA-N |