ethyl 4-{[2-(2,5-difluoroanilino)-2-oxoethyl](methyl)sulfamoyl}-1-methyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
ethyl 4-{[2-(2,5-difluoroanilino)-2-oxoethyl](methyl)sulfamoyl}-1-methyl-1H-pyrrole-2-carboxylate
ethyl 4-{[2-(2,5-difluoroanilino)-2-oxoethyl](methyl)sulfamoyl}-1-methyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | F065-4286 |
| Compound Name: | ethyl 4-{[2-(2,5-difluoroanilino)-2-oxoethyl](methyl)sulfamoyl}-1-methyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 415.41 |
| Molecular Formula: | C17 H19 F2 N3 O5 S |
| Smiles: | CCOC(c1cc(cn1C)S(N(C)CC(Nc1cc(ccc1F)F)=O)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8934 |
| logD: | 1.8077 |
| logSw: | -2.7996 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.318 |
| InChI Key: | FPQVYNFYJUQSBD-UHFFFAOYSA-N |