2-{[2-(3-chlorophenyl)-2-oxoethyl]sulfanyl}-3-(4-fluorophenyl)-4-oxo-N-(propan-2-yl)-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
2-{[2-(3-chlorophenyl)-2-oxoethyl]sulfanyl}-3-(4-fluorophenyl)-4-oxo-N-(propan-2-yl)-3,4-dihydroquinazoline-7-carboxamide
2-{[2-(3-chlorophenyl)-2-oxoethyl]sulfanyl}-3-(4-fluorophenyl)-4-oxo-N-(propan-2-yl)-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | F067-1436 |
| Compound Name: | 2-{[2-(3-chlorophenyl)-2-oxoethyl]sulfanyl}-3-(4-fluorophenyl)-4-oxo-N-(propan-2-yl)-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 509.99 |
| Molecular Formula: | C26 H21 Cl F N3 O3 S |
| Smiles: | CC(C)NC(c1ccc2C(N(C(=Nc2c1)SCC(c1cccc(c1)[Cl])=O)c1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6004 |
| logD: | 4.6003 |
| logSw: | -4.7021 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.065 |
| InChI Key: | LYCSOEBXVZLVBB-UHFFFAOYSA-N |