2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-N-cyclopentyl-3-(4-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-N-cyclopentyl-3-(4-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-N-cyclopentyl-3-(4-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | F067-1439 |
| Compound Name: | 2-{[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl}-N-cyclopentyl-3-(4-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 536.02 |
| Molecular Formula: | C28 H23 Cl F N3 O3 S |
| Smiles: | C1CCC(C1)NC(c1ccc2C(N(C(=Nc2c1)SCC(c1ccc(cc1)[Cl])=O)c1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0205 |
| logD: | 5.0204 |
| logSw: | -5.2304 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.911 |
| InChI Key: | BJQLCAMZKQHBPT-UHFFFAOYSA-N |