N-(propan-2-yl)-4-[3-(trifluoromethyl)quinoxalin-2-yl]piperazine-1-carboxamide
Chemical Structure Depiction of
N-(propan-2-yl)-4-[3-(trifluoromethyl)quinoxalin-2-yl]piperazine-1-carboxamide
N-(propan-2-yl)-4-[3-(trifluoromethyl)quinoxalin-2-yl]piperazine-1-carboxamide
Compound characteristics
| Compound ID: | F070-1221 |
| Compound Name: | N-(propan-2-yl)-4-[3-(trifluoromethyl)quinoxalin-2-yl]piperazine-1-carboxamide |
| Molecular Weight: | 367.37 |
| Molecular Formula: | C17 H20 F3 N5 O |
| Smiles: | [H]c1cc2c(cc1[H])nc(c(C(F)(F)F)n2)N1CCN(CC1)C(NC(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4318 |
| logD: | 3.4318 |
| logSw: | -3.6153 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.172 |
| InChI Key: | NLIBMAHUXSCHPI-UHFFFAOYSA-N |