N-(5-chloro-2,4-dimethoxyphenyl)-5-methyl-3-(pyridin-3-yl)-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
N-(5-chloro-2,4-dimethoxyphenyl)-5-methyl-3-(pyridin-3-yl)-1,2-oxazole-4-carboxamide
N-(5-chloro-2,4-dimethoxyphenyl)-5-methyl-3-(pyridin-3-yl)-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | F082-0021 |
| Compound Name: | N-(5-chloro-2,4-dimethoxyphenyl)-5-methyl-3-(pyridin-3-yl)-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 373.79 |
| Molecular Formula: | C18 H16 Cl N3 O4 |
| Smiles: | Cc1c(C(Nc2cc(c(cc2OC)OC)[Cl])=O)c(c2cccnc2)no1 |
| Stereo: | ACHIRAL |
| logP: | 2.6891 |
| logD: | 2.6315 |
| logSw: | -3.9405 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.371 |
| InChI Key: | DRWGWCBGDMFART-UHFFFAOYSA-N |