3-(5-bromothiophen-2-yl)-5-methyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
3-(5-bromothiophen-2-yl)-5-methyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,2-oxazole-4-carboxamide
3-(5-bromothiophen-2-yl)-5-methyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | F082-0902 |
| Compound Name: | 3-(5-bromothiophen-2-yl)-5-methyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 412.3 |
| Molecular Formula: | C16 H18 Br N3 O3 S |
| Smiles: | Cc1c(C(NCCCN2CCCC2=O)=O)c(c2ccc(s2)[Br])no1 |
| Stereo: | ACHIRAL |
| logP: | 1.5824 |
| logD: | 1.5824 |
| logSw: | -2.3214 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.984 |
| InChI Key: | ILRCCGHOICDMFY-UHFFFAOYSA-N |