[4-amino-2-(3-chloroanilino)-1,3-thiazol-5-yl](2,4-dimethylphenyl)methanone
Chemical Structure Depiction of
[4-amino-2-(3-chloroanilino)-1,3-thiazol-5-yl](2,4-dimethylphenyl)methanone
[4-amino-2-(3-chloroanilino)-1,3-thiazol-5-yl](2,4-dimethylphenyl)methanone
Compound characteristics
| Compound ID: | F091-0376 |
| Compound Name: | [4-amino-2-(3-chloroanilino)-1,3-thiazol-5-yl](2,4-dimethylphenyl)methanone |
| Molecular Weight: | 357.86 |
| Molecular Formula: | C18 H16 Cl N3 O S |
| Smiles: | Cc1ccc(C(c2c(N)nc(Nc3cccc(c3)[Cl])s2)=O)c(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.8548 |
| logD: | 5.8548 |
| logSw: | -5.8547 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 53.361 |
| InChI Key: | CWCKJVQTPPDVBK-UHFFFAOYSA-N |