[4-amino-2-(4-chloro-2-methylanilino)-1,3-thiazol-5-yl](phenyl)methanone
Chemical Structure Depiction of
[4-amino-2-(4-chloro-2-methylanilino)-1,3-thiazol-5-yl](phenyl)methanone
[4-amino-2-(4-chloro-2-methylanilino)-1,3-thiazol-5-yl](phenyl)methanone
Compound characteristics
| Compound ID: | F091-0908 |
| Compound Name: | [4-amino-2-(4-chloro-2-methylanilino)-1,3-thiazol-5-yl](phenyl)methanone |
| Molecular Weight: | 343.83 |
| Molecular Formula: | C17 H14 Cl N3 O S |
| Smiles: | Cc1cc(ccc1Nc1nc(c(C(c2ccccc2)=O)s1)N)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.1958 |
| logD: | 5.1958 |
| logSw: | -5.6168 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 52.663 |
| InChI Key: | BRZJOXJMOJKQID-UHFFFAOYSA-N |