{4-amino-2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-1,3-thiazol-5-yl}(4-ethylphenyl)methanone
Chemical Structure Depiction of
{4-amino-2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-1,3-thiazol-5-yl}(4-ethylphenyl)methanone
{4-amino-2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-1,3-thiazol-5-yl}(4-ethylphenyl)methanone
Compound characteristics
| Compound ID: | F091-1311 |
| Compound Name: | {4-amino-2-[(2,3-dihydro-1,4-benzodioxin-6-yl)amino]-1,3-thiazol-5-yl}(4-ethylphenyl)methanone |
| Molecular Weight: | 381.45 |
| Molecular Formula: | C20 H19 N3 O3 S |
| Smiles: | CCc1ccc(cc1)C(c1c(N)nc(Nc2ccc3c(c2)OCCO3)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0839 |
| logD: | 4.0839 |
| logSw: | -4.3471 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 69.184 |
| InChI Key: | WTSBOAPLZIGGAA-UHFFFAOYSA-N |