N-[1-(2H-1,3-benzodioxol-5-yl)-3-(4-fluorophenyl)propan-2-yl]-N'-(3,5-dimethoxyphenyl)urea
Chemical Structure Depiction of
N-[1-(2H-1,3-benzodioxol-5-yl)-3-(4-fluorophenyl)propan-2-yl]-N'-(3,5-dimethoxyphenyl)urea
N-[1-(2H-1,3-benzodioxol-5-yl)-3-(4-fluorophenyl)propan-2-yl]-N'-(3,5-dimethoxyphenyl)urea
Compound characteristics
| Compound ID: | F107-1191 |
| Compound Name: | N-[1-(2H-1,3-benzodioxol-5-yl)-3-(4-fluorophenyl)propan-2-yl]-N'-(3,5-dimethoxyphenyl)urea |
| Molecular Weight: | 452.48 |
| Molecular Formula: | C25 H25 F N2 O5 |
| Smiles: | COc1cc(cc(c1)OC)NC(NC(Cc1ccc(cc1)F)Cc1ccc2c(c1)OCO2)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4005 |
| logD: | 5.4005 |
| logSw: | -5.4716 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.704 |
| InChI Key: | QNELORJMMPBLMH-IBGZPJMESA-N |