N-[1,3-bis(2H-1,3-benzodioxol-5-yl)propan-2-yl]-N'-(2-methylphenyl)urea
Chemical Structure Depiction of
N-[1,3-bis(2H-1,3-benzodioxol-5-yl)propan-2-yl]-N'-(2-methylphenyl)urea
N-[1,3-bis(2H-1,3-benzodioxol-5-yl)propan-2-yl]-N'-(2-methylphenyl)urea
Compound characteristics
| Compound ID: | F107-1958 |
| Compound Name: | N-[1,3-bis(2H-1,3-benzodioxol-5-yl)propan-2-yl]-N'-(2-methylphenyl)urea |
| Molecular Weight: | 432.48 |
| Molecular Formula: | C25 H24 N2 O5 |
| Smiles: | Cc1ccccc1NC(NC(Cc1ccc2c(c1)OCO2)Cc1ccc2c(c1)OCO2)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9138 |
| logD: | 4.9138 |
| logSw: | -4.6779 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.034 |
| InChI Key: | XFZLFCFSTYXZNB-UHFFFAOYSA-N |