N-benzyl-5-methyl-3-phenyl[1,2]oxazolo[4,5-d]pyrimidin-7-amine
Chemical Structure Depiction of
N-benzyl-5-methyl-3-phenyl[1,2]oxazolo[4,5-d]pyrimidin-7-amine
N-benzyl-5-methyl-3-phenyl[1,2]oxazolo[4,5-d]pyrimidin-7-amine
Compound characteristics
| Compound ID: | F109-1532 |
| Compound Name: | N-benzyl-5-methyl-3-phenyl[1,2]oxazolo[4,5-d]pyrimidin-7-amine |
| Molecular Weight: | 316.36 |
| Molecular Formula: | C19 H16 N4 O |
| Smiles: | Cc1nc(c2c(c(c3ccccc3)no2)n1)NCc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.4612 |
| logD: | 3.4589 |
| logSw: | -3.5252 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.214 |
| InChI Key: | JFXKVHZWKZAEDS-UHFFFAOYSA-N |