4-benzyl-N-(3,4-dimethylphenyl)-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxamide
Chemical Structure Depiction of
4-benzyl-N-(3,4-dimethylphenyl)-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxamide
4-benzyl-N-(3,4-dimethylphenyl)-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxamide
Compound characteristics
| Compound ID: | F119-0076 |
| Compound Name: | 4-benzyl-N-(3,4-dimethylphenyl)-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxamide |
| Molecular Weight: | 386.45 |
| Molecular Formula: | C24 H22 N2 O3 |
| Smiles: | Cc1ccc(cc1C)NC(c1ccc2c(c1)N(Cc1ccccc1)C(CO2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6677 |
| logD: | 4.6677 |
| logSw: | -4.4628 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.159 |
| InChI Key: | MCHUWQDRHNVEOA-UHFFFAOYSA-N |