6-(piperidine-1-carbonyl)-2H-1,4-benzoxazin-3(4H)-one
Chemical Structure Depiction of
6-(piperidine-1-carbonyl)-2H-1,4-benzoxazin-3(4H)-one
6-(piperidine-1-carbonyl)-2H-1,4-benzoxazin-3(4H)-one
Compound characteristics
| Compound ID: | F119-0270 |
| Compound Name: | 6-(piperidine-1-carbonyl)-2H-1,4-benzoxazin-3(4H)-one |
| Molecular Weight: | 260.29 |
| Molecular Formula: | C14 H16 N2 O3 |
| Smiles: | [H]N1C(COc2ccc(cc12)C(N1CCCCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.0107 |
| logD: | 1.0107 |
| logSw: | -2.1018 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.157 |
| InChI Key: | JDTZRMPEVIBPKL-UHFFFAOYSA-N |