N-(3-chloro-2-methylphenyl)-N'-{2-[2-(4-methylphenyl)-1H-benzimidazol-1-yl]ethyl}urea
Chemical Structure Depiction of
N-(3-chloro-2-methylphenyl)-N'-{2-[2-(4-methylphenyl)-1H-benzimidazol-1-yl]ethyl}urea
N-(3-chloro-2-methylphenyl)-N'-{2-[2-(4-methylphenyl)-1H-benzimidazol-1-yl]ethyl}urea
Compound characteristics
| Compound ID: | F120-0120 |
| Compound Name: | N-(3-chloro-2-methylphenyl)-N'-{2-[2-(4-methylphenyl)-1H-benzimidazol-1-yl]ethyl}urea |
| Molecular Weight: | 418.93 |
| Molecular Formula: | C24 H23 Cl N4 O |
| Smiles: | Cc1ccc(cc1)c1nc2ccccc2n1CCNC(Nc1cccc(c1C)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.3211 |
| logD: | 6.3162 |
| logSw: | -6.1372 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.914 |
| InChI Key: | MODUNJWWLJLJQI-UHFFFAOYSA-N |