1-(4-ethoxybenzene-1-sulfonyl)-4-{[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl}piperazine
Chemical Structure Depiction of
1-(4-ethoxybenzene-1-sulfonyl)-4-{[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl}piperazine
1-(4-ethoxybenzene-1-sulfonyl)-4-{[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl}piperazine
Compound characteristics
| Compound ID: | F123-0173 |
| Compound Name: | 1-(4-ethoxybenzene-1-sulfonyl)-4-{[5-methyl-2-(2-methylphenyl)-1,3-oxazol-4-yl]methyl}piperazine |
| Molecular Weight: | 455.58 |
| Molecular Formula: | C24 H29 N3 O4 S |
| Smiles: | CCOc1ccc(cc1)S(N1CCN(CC1)Cc1c(C)oc(c2ccccc2C)n1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8459 |
| logD: | 3.8457 |
| logSw: | -3.8935 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 60.736 |
| InChI Key: | CXBLOBLRESGQEL-UHFFFAOYSA-N |