1-{[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-4-(2,4,6-trimethylbenzene-1-sulfonyl)piperazine
Chemical Structure Depiction of
1-{[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-4-(2,4,6-trimethylbenzene-1-sulfonyl)piperazine
1-{[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-4-(2,4,6-trimethylbenzene-1-sulfonyl)piperazine
Compound characteristics
| Compound ID: | F123-0181 |
| Compound Name: | 1-{[2-(2-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-4-(2,4,6-trimethylbenzene-1-sulfonyl)piperazine |
| Molecular Weight: | 469.6 |
| Molecular Formula: | C25 H31 N3 O4 S |
| Smiles: | Cc1cc(C)c(c(C)c1)S(N1CCN(CC1)Cc1c(C)oc(c2ccccc2OC)n1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2494 |
| logD: | 4.2493 |
| logSw: | -4.2894 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 61.242 |
| InChI Key: | YRPISWMPSLTPKZ-UHFFFAOYSA-N |