4-amino-N-(3-fluorophenyl)-3-(4-methylphenyl)-2-sulfanylidene-2,3-dihydro-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
4-amino-N-(3-fluorophenyl)-3-(4-methylphenyl)-2-sulfanylidene-2,3-dihydro-1,3-thiazole-5-carboxamide
4-amino-N-(3-fluorophenyl)-3-(4-methylphenyl)-2-sulfanylidene-2,3-dihydro-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | F128-0272 |
| Compound Name: | 4-amino-N-(3-fluorophenyl)-3-(4-methylphenyl)-2-sulfanylidene-2,3-dihydro-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 359.44 |
| Molecular Formula: | C17 H14 F N3 O S2 |
| Smiles: | Cc1ccc(cc1)N1C(=C(C(Nc2cccc(c2)F)=O)SC1=S)N |
| Stereo: | ACHIRAL |
| logP: | 3.7575 |
| logD: | 3.7575 |
| logSw: | -4.0814 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 46.206 |
| InChI Key: | SKNVAZRRSALCEQ-UHFFFAOYSA-N |