4-amino-3-(2,6-diethylphenyl)-N-[(furan-2-yl)methyl]-2-sulfanylidene-2,3-dihydro-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
4-amino-3-(2,6-diethylphenyl)-N-[(furan-2-yl)methyl]-2-sulfanylidene-2,3-dihydro-1,3-thiazole-5-carboxamide
4-amino-3-(2,6-diethylphenyl)-N-[(furan-2-yl)methyl]-2-sulfanylidene-2,3-dihydro-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | F128-0298 |
| Compound Name: | 4-amino-3-(2,6-diethylphenyl)-N-[(furan-2-yl)methyl]-2-sulfanylidene-2,3-dihydro-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 387.52 |
| Molecular Formula: | C19 H21 N3 O2 S2 |
| Smiles: | CCc1cccc(CC)c1N1C(=C(C(NCc2ccco2)=O)SC1=S)N |
| Stereo: | ACHIRAL |
| logP: | 4.5842 |
| logD: | 4.5842 |
| logSw: | -4.4704 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 54.675 |
| InChI Key: | GITAGVMXZSLDEA-UHFFFAOYSA-N |