N-(3,4-dimethoxyphenyl)-N'-[2-oxo-4-(propylamino)-2H-1-benzopyran-3-yl]urea
Chemical Structure Depiction of
N-(3,4-dimethoxyphenyl)-N'-[2-oxo-4-(propylamino)-2H-1-benzopyran-3-yl]urea
N-(3,4-dimethoxyphenyl)-N'-[2-oxo-4-(propylamino)-2H-1-benzopyran-3-yl]urea
Compound characteristics
| Compound ID: | F129-0134 |
| Compound Name: | N-(3,4-dimethoxyphenyl)-N'-[2-oxo-4-(propylamino)-2H-1-benzopyran-3-yl]urea |
| Molecular Weight: | 397.43 |
| Molecular Formula: | C21 H23 N3 O5 |
| Smiles: | CCCNC1=C(C(=O)Oc2ccccc12)NC(Nc1ccc(c(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.847 |
| logD: | 2.8438 |
| logSw: | -3.5587 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 79.47 |
| InChI Key: | CEPDCFLTVACJMZ-UHFFFAOYSA-N |