N-[4-(benzylamino)-2-oxo-2H-1-benzopyran-3-yl]-N'-[(3-methoxyphenyl)methyl]urea
Chemical Structure Depiction of
N-[4-(benzylamino)-2-oxo-2H-1-benzopyran-3-yl]-N'-[(3-methoxyphenyl)methyl]urea
N-[4-(benzylamino)-2-oxo-2H-1-benzopyran-3-yl]-N'-[(3-methoxyphenyl)methyl]urea
Compound characteristics
| Compound ID: | F129-0480 |
| Compound Name: | N-[4-(benzylamino)-2-oxo-2H-1-benzopyran-3-yl]-N'-[(3-methoxyphenyl)methyl]urea |
| Molecular Weight: | 429.47 |
| Molecular Formula: | C25 H23 N3 O4 |
| Smiles: | COc1cccc(CNC(NC2=C(c3ccccc3OC2=O)NCc2ccccc2)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.2286 |
| logD: | 3.0653 |
| logSw: | -3.7536 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 72.962 |
| InChI Key: | XGUTYKMLUPIMAN-UHFFFAOYSA-N |