N-{4-[6-(methanesulfonyl)pyridazin-3-yl]phenyl}-4-phenylbutanamide
Chemical Structure Depiction of
N-{4-[6-(methanesulfonyl)pyridazin-3-yl]phenyl}-4-phenylbutanamide
N-{4-[6-(methanesulfonyl)pyridazin-3-yl]phenyl}-4-phenylbutanamide
Compound characteristics
| Compound ID: | F133-0036 |
| Compound Name: | N-{4-[6-(methanesulfonyl)pyridazin-3-yl]phenyl}-4-phenylbutanamide |
| Molecular Weight: | 395.48 |
| Molecular Formula: | C21 H21 N3 O3 S |
| Smiles: | CS(c1ccc(c2ccc(cc2)NC(CCCc2ccccc2)=O)nn1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9669 |
| logD: | 2.9668 |
| logSw: | -3.7525 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.111 |
| InChI Key: | VKHNTGJOVIZOQF-UHFFFAOYSA-N |