N-{4-[6-(ethanesulfonyl)pyridazin-3-yl]phenyl}-2-ethoxyacetamide
Chemical Structure Depiction of
N-{4-[6-(ethanesulfonyl)pyridazin-3-yl]phenyl}-2-ethoxyacetamide
N-{4-[6-(ethanesulfonyl)pyridazin-3-yl]phenyl}-2-ethoxyacetamide
Compound characteristics
| Compound ID: | F133-0147 |
| Compound Name: | N-{4-[6-(ethanesulfonyl)pyridazin-3-yl]phenyl}-2-ethoxyacetamide |
| Molecular Weight: | 349.41 |
| Molecular Formula: | C16 H19 N3 O4 S |
| Smiles: | CCOCC(Nc1ccc(cc1)c1ccc(nn1)S(CC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4564 |
| logD: | 1.4564 |
| logSw: | -2.4176 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.729 |
| InChI Key: | FTOLFKMQUOMQIW-UHFFFAOYSA-N |