N-cycloheptyl-5-(6,7-dimethoxy-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl)pentanamide
Chemical Structure Depiction of
N-cycloheptyl-5-(6,7-dimethoxy-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl)pentanamide
N-cycloheptyl-5-(6,7-dimethoxy-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl)pentanamide
Compound characteristics
| Compound ID: | F142-0051 |
| Compound Name: | N-cycloheptyl-5-(6,7-dimethoxy-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl)pentanamide |
| Molecular Weight: | 417.5 |
| Molecular Formula: | C22 H31 N3 O5 |
| Smiles: | COc1cc2C(N(CCCCC(NC3CCCCCC3)=O)C(Nc2cc1OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9171 |
| logD: | 2.9009 |
| logSw: | -3.3601 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 80.247 |
| InChI Key: | WFLDLRUHXHVSEH-UHFFFAOYSA-N |