5-[1-(2-anilino-2-oxoethyl)-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl]-N-[(thiophen-2-yl)methyl]pentanamide
Chemical Structure Depiction of
5-[1-(2-anilino-2-oxoethyl)-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl]-N-[(thiophen-2-yl)methyl]pentanamide
5-[1-(2-anilino-2-oxoethyl)-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl]-N-[(thiophen-2-yl)methyl]pentanamide
Compound characteristics
| Compound ID: | F142-0662 |
| Compound Name: | 5-[1-(2-anilino-2-oxoethyl)-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl]-N-[(thiophen-2-yl)methyl]pentanamide |
| Molecular Weight: | 490.58 |
| Molecular Formula: | C26 H26 N4 O4 S |
| Smiles: | C(CCN1C(c2ccccc2N(CC(Nc2ccccc2)=O)C1=O)=O)CC(NCc1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9619 |
| logD: | 2.9619 |
| logSw: | -3.7009 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.884 |
| InChI Key: | PDVAFVUVHLURFC-UHFFFAOYSA-N |