N-cyclohexyl-2-(4-{1-[(2,5-dimethylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}phenyl)acetamide
Chemical Structure Depiction of
N-cyclohexyl-2-(4-{1-[(2,5-dimethylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}phenyl)acetamide
N-cyclohexyl-2-(4-{1-[(2,5-dimethylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}phenyl)acetamide
Compound characteristics
| Compound ID: | F144-0334 |
| Compound Name: | N-cyclohexyl-2-(4-{1-[(2,5-dimethylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}phenyl)acetamide |
| Molecular Weight: | 495.62 |
| Molecular Formula: | C31 H33 N3 O3 |
| Smiles: | Cc1ccc(C)c(CN2C(N(C(c3ccccc23)=O)c2ccc(CC(NC3CCCCC3)=O)cc2)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.2159 |
| logD: | 5.2159 |
| logSw: | -4.9709 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.581 |
| InChI Key: | LOVSPAOEMCFOJK-UHFFFAOYSA-N |