2-(4-{1-[(2,5-dimethylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}phenyl)-N-(3-methylphenyl)acetamide
					Chemical Structure Depiction of
2-(4-{1-[(2,5-dimethylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}phenyl)-N-(3-methylphenyl)acetamide
			2-(4-{1-[(2,5-dimethylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}phenyl)-N-(3-methylphenyl)acetamide
Compound characteristics
| Compound ID: | F144-0401 | 
| Compound Name: | 2-(4-{1-[(2,5-dimethylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}phenyl)-N-(3-methylphenyl)acetamide | 
| Molecular Weight: | 503.6 | 
| Molecular Formula: | C32 H29 N3 O3 | 
| Smiles: | Cc1cccc(c1)NC(Cc1ccc(cc1)N1C(c2ccccc2N(Cc2cc(C)ccc2C)C1=O)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 5.622 | 
| logD: | 5.622 | 
| logSw: | -5.4151 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 53.533 | 
| InChI Key: | NIQOPRKMRDOCEO-UHFFFAOYSA-N | 
 
				 
				