3-(7-tert-butyl-4-oxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-2-yl)-N-(3-fluoro-4-methylphenyl)propanamide
Chemical Structure Depiction of
3-(7-tert-butyl-4-oxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-2-yl)-N-(3-fluoro-4-methylphenyl)propanamide
3-(7-tert-butyl-4-oxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-2-yl)-N-(3-fluoro-4-methylphenyl)propanamide
Compound characteristics
| Compound ID: | F145-0719 |
| Compound Name: | 3-(7-tert-butyl-4-oxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-2-yl)-N-(3-fluoro-4-methylphenyl)propanamide |
| Molecular Weight: | 441.57 |
| Molecular Formula: | C24 H28 F N3 O2 S |
| Smiles: | Cc1ccc(cc1F)NC(CCC1NC(c2c3CCC(Cc3sc2N=1)C(C)(C)C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4126 |
| logD: | 5.412 |
| logSw: | -5.4399 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.873 |
| InChI Key: | ISJDXXZOKRBAMV-CQSZACIVSA-N |