N-(3-ethylphenyl)-3-(4-methylphenyl)cinnoline-4-carboxamide
Chemical Structure Depiction of
N-(3-ethylphenyl)-3-(4-methylphenyl)cinnoline-4-carboxamide
N-(3-ethylphenyl)-3-(4-methylphenyl)cinnoline-4-carboxamide
Compound characteristics
| Compound ID: | F146-1225 |
| Compound Name: | N-(3-ethylphenyl)-3-(4-methylphenyl)cinnoline-4-carboxamide |
| Molecular Weight: | 367.45 |
| Molecular Formula: | C24 H21 N3 O |
| Smiles: | [H]c1ccc2c(c1)c(C(Nc1cccc(CC)c1)=O)c(c1ccc(C)cc1)nn2 |
| Stereo: | ACHIRAL |
| logP: | 5.3231 |
| logD: | 5.3231 |
| logSw: | -5.6035 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.286 |
| InChI Key: | GKMCOMPFVDBWMY-UHFFFAOYSA-N |