(morpholin-4-yl)(3-phenylcinnolin-4-yl)methanone
Chemical Structure Depiction of
(morpholin-4-yl)(3-phenylcinnolin-4-yl)methanone
(morpholin-4-yl)(3-phenylcinnolin-4-yl)methanone
Compound characteristics
| Compound ID: | F146-1718 |
| Compound Name: | (morpholin-4-yl)(3-phenylcinnolin-4-yl)methanone |
| Molecular Weight: | 319.36 |
| Molecular Formula: | C19 H17 N3 O2 |
| Smiles: | [H]c1ccc2c(c1)c(C(N1CCOCC1)=O)c(c1ccccc1)nn2 |
| Stereo: | ACHIRAL |
| logP: | 1.9945 |
| logD: | 1.9945 |
| logSw: | -2.1783 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.752 |
| InChI Key: | BQINILMQHCPXOY-UHFFFAOYSA-N |