(4-benzylpiperidin-1-yl)(6-methyl-3-phenylcinnolin-4-yl)methanone
Chemical Structure Depiction of
(4-benzylpiperidin-1-yl)(6-methyl-3-phenylcinnolin-4-yl)methanone
(4-benzylpiperidin-1-yl)(6-methyl-3-phenylcinnolin-4-yl)methanone
Compound characteristics
| Compound ID: | F146-1970 |
| Compound Name: | (4-benzylpiperidin-1-yl)(6-methyl-3-phenylcinnolin-4-yl)methanone |
| Molecular Weight: | 421.54 |
| Molecular Formula: | C28 H27 N3 O |
| Smiles: | Cc1ccc2c(c1)c(C(N1CCC(CC1)Cc1ccccc1)=O)c(c1ccccc1)nn2 |
| Stereo: | ACHIRAL |
| logP: | 5.6938 |
| logD: | 5.6937 |
| logSw: | -5.7419 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.572 |
| InChI Key: | NXKZCRXTMTVZBV-UHFFFAOYSA-N |