N-[(4-fluorophenyl)methyl]-6-methyl-3-phenylcinnoline-4-carboxamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-6-methyl-3-phenylcinnoline-4-carboxamide
N-[(4-fluorophenyl)methyl]-6-methyl-3-phenylcinnoline-4-carboxamide
Compound characteristics
| Compound ID: | F146-1972 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-6-methyl-3-phenylcinnoline-4-carboxamide |
| Molecular Weight: | 371.41 |
| Molecular Formula: | C23 H18 F N3 O |
| Smiles: | Cc1ccc2c(c1)c(C(NCc1ccc(cc1)F)=O)c(c1ccccc1)nn2 |
| Stereo: | ACHIRAL |
| logP: | 4.1421 |
| logD: | 4.1421 |
| logSw: | -4.3088 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.609 |
| InChI Key: | KZVZFPBPBPMTLF-UHFFFAOYSA-N |