(3-methylphenyl)methyl 1-(4-bromophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
(3-methylphenyl)methyl 1-(4-bromophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
(3-methylphenyl)methyl 1-(4-bromophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | F152-0088 |
| Compound Name: | (3-methylphenyl)methyl 1-(4-bromophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 386.25 |
| Molecular Formula: | C18 H16 Br N3 O2 |
| Smiles: | Cc1cccc(COC(c2c(C)n(c3ccc(cc3)[Br])nn2)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.5266 |
| logD: | 4.5266 |
| logSw: | -4.5787 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.939 |
| InChI Key: | PXOJWXHMQIOWOJ-UHFFFAOYSA-N |