(4-ethylphenyl)methyl 1-(4-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Chemical Structure Depiction of
(4-ethylphenyl)methyl 1-(4-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
(4-ethylphenyl)methyl 1-(4-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate
Compound characteristics
| Compound ID: | F152-0162 |
| Compound Name: | (4-ethylphenyl)methyl 1-(4-methoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylate |
| Molecular Weight: | 351.4 |
| Molecular Formula: | C20 H21 N3 O3 |
| Smiles: | CCc1ccc(COC(c2c(C)n(c3ccc(cc3)OC)nn2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.9092 |
| logD: | 3.9092 |
| logSw: | -4.0827 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.483 |
| InChI Key: | MCNYZVUDTGSWEW-UHFFFAOYSA-N |